CAS 193807-58-8 appears in our catalog under these names: MMP-2/MMP-9 Inhibitor I, MMP-2/MMP-9 Inhibitor I/ 99.74% (existing batch purity), MMP–2/MMP–9 Inhibitor I, MMP-2/MMP-9 Inhibitor I 1PC X 5MG, (R)-2-([1,1'-Biphenyl]-4-ylsulfonamido)-3-phenylpropanoic acid, 99%, 99%. Offered by: TRC, TargetMol, GLPBio, Biosynth, Sigma-Aldrich. Available pack sizes: 25mg, 1mg, 5mg, 10mg, 50mg, 100mg, 500mg, 250mg.
(2R)-3-phenyl-2-[(4-phenylphenyl)sulfonylamino]propanoic acid (CAS 193807-58-8) is a chemical compound with the molecular formula C21H19NO4S and a molecular weight of 381.4 g/mol. IUPAC name: (2R)-3-phenyl-2-[(4-phenylphenyl)sulfonylamino]propanoic acid. InChIKey: JBYHBQIDTNHWJF-HXUWFJFHSA-N.
| Molecular formula | C21H19NO4S |
|---|---|
| Molecular weight | 381.4 g/mol |
| IUPAC name | (2R)-3-phenyl-2-[(4-phenylphenyl)sulfonylamino]propanoic acid |
| InChIKey | JBYHBQIDTNHWJF-HXUWFJFHSA-N |
| SMILES | C1=CC=C(C=C1)C[C@H](C(=O)O)NS(=O)(=O)C2=CC=C(C=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)