CAS 352693-80-2 appears in our catalog under these names: MMRi62/ 99.7% (existing batch purity), MMRi62, MMRi62 99%, 7-[(2,3-DICHLOROPHENYL)(PYRIDIN-2-YLAMINO)METHYL]QUINOLIN-8-OL, 95%+, 95%+, MMRi62, 99.59%. Offered by: TargetMol, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 10mM (in 1ml dmso).
7-[(2,3-dichlorophenyl)-(pyridin-2-ylamino)methyl]quinolin-8-ol (CAS 352693-80-2) is a chemical compound with the molecular formula C21H15Cl2N3O and a molecular weight of 396.3 g/mol. IUPAC name: 7-[(2,3-dichlorophenyl)-(pyridin-2-ylamino)methyl]quinolin-8-ol. InChIKey: FMUBUUSODRAEMS-UHFFFAOYSA-N.
| Molecular formula | C21H15Cl2N3O |
|---|---|
| Molecular weight | 396.3 g/mol |
| IUPAC name | 7-[(2,3-dichlorophenyl)-(pyridin-2-ylamino)methyl]quinolin-8-ol |
| InChIKey | FMUBUUSODRAEMS-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)NC(C2=C(C(=CC=C2)Cl)Cl)C3=C(C4=C(C=CC=N4)C=C3)O |
Computed by PubChem (NCBI)