CAS 430458-66-5 appears in our catalog under these names: MMRi64, MMRi64, 98%, MMRi64/ 99.61% (existing batch purity), MMRi64 98%, 7-((2,3-Dichlorophenyl)((4-methylpyridin-2-yl)amino)methyl)quinolin-8-ol, 98%, 98%. Offered by: GLPBio, AmBeed, TargetMol, Chemat, MedChemExpress. Available pack sizes: 5mg, 1mg, 100mg, 10mg, 25mg, 50mg, 500mg, 10 mg.
7-[(2,3-dichlorophenyl)-[(4-methyl-2-pyridinyl)amino]methyl]quinolin-8-ol (CAS 430458-66-5) is a chemical compound with the molecular formula C22H17Cl2N3O and a molecular weight of 410.3 g/mol. IUPAC name: 7-[(2,3-dichlorophenyl)-[(4-methyl-2-pyridinyl)amino]methyl]quinolin-8-ol. InChIKey: HQICAVDTVBACIN-UHFFFAOYSA-N.
| Molecular formula | C22H17Cl2N3O |
|---|---|
| Molecular weight | 410.3 g/mol |
| IUPAC name | 7-[(2,3-dichlorophenyl)-[(4-methyl-2-pyridinyl)amino]methyl]quinolin-8-ol |
| InChIKey | HQICAVDTVBACIN-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC=C1)NC(C2=C(C(=CC=C2)Cl)Cl)C3=C(C4=C(C=CC=N4)C=C3)O |
Computed by PubChem (NCBI)