CAS 1314883-11-8 appears in our catalog under these names: MMV390048, MMV390048/ 98.28% (existing batch purity), MMV390048 98%, 5-[4-(Methylsulfonyl)phenyl]-6'-(trifluoromethyl)[3,3'-bipyridin]-2-amine, 98%, 98%, MMV390048, 98.85%. Offered by: GLPBio, TargetMol, Ambeed, Chemat, MedChemExpress. Available pack sizes: 1mg, 10mg, 25mg, 5mg, 10mM (in 1ml dmso), 50mg, 100mg, 250mg.
5-(4-methylsulfonylphenyl)-3-[6-(trifluoromethyl)-3-pyridinyl]pyridin-2-amine (CAS 1314883-11-8) is a chemical compound with the molecular formula C18H14F3N3O2S and a molecular weight of 393.4 g/mol. IUPAC name: 5-(4-methylsulfonylphenyl)-3-[6-(trifluoromethyl)-3-pyridinyl]pyridin-2-amine. InChIKey: RTJQABCNNLMCJF-UHFFFAOYSA-N.
| Molecular formula | C18H14F3N3O2S |
|---|---|
| Molecular weight | 393.4 g/mol |
| IUPAC name | 5-(4-methylsulfonylphenyl)-3-[6-(trifluoromethyl)-3-pyridinyl]pyridin-2-amine |
| InChIKey | RTJQABCNNLMCJF-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC=C(C=C1)C2=CC(=C(N=C2)N)C3=CN=C(C=C3)C(F)(F)F |
Computed by PubChem (NCBI)