MMV688845
cas: 2208962-35-8 — see every product listed under this CAS number, including other names
MMV688845 (CAS 2208962-35-8) is a chemical reagent available from Chemat. Available pack sizes: 2mg, 10mg, 100mg, 25mg, 5mg, 50mg, 1mg. Offered by: TargetMol, GLPBio, Chemat.
| brand | TargetMol |
|---|---|
| catalog number | T73271-2mg |
| cas | 2208962-35-8 |
| size | 2mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| TargetMol | 2mg | 718.19 Pln | |
| GLPBio | 10mg | 1341.24 Pln | |
| GLPBio | 100mg | 5048.20 Pln | |
| GLPBio | 25mg | 2204.79 Pln | |
| GLPBio | 5mg | 962.12 Pln | |
| GLPBio | 50mg | 3278.97 Pln | |
| Chemat | 1mg | 390.80 Pln | |
| Chemat | 5mg | 789.20 Pln | |
| Chemat | 10mg | 1307.60 Pln | |
| Chemat | 25mg | 2430.80 Pln | |
| Chemat | 50mg | 3438.80 Pln |
properties
| purity | No data |
|---|---|
| delivery time | approx. 26 days |
N-[(2R)-1-(2-morpholin-4-ylanilino)-1-oxo-3-phenylpropan-2-yl]thiophene-2-carboxamide (CAS 2208962-35-8) is a chemical compound with the molecular formula C24H25N3O3S and a molecular weight of 435.5 g/mol. IUPAC name: N-[(2R)-1-(2-morpholin-4-ylanilino)-1-oxo-3-phenylpropan-2-yl]thiophene-2-carboxamide. InChIKey: YZLODHPDCSNHTP-HXUWFJFHSA-N.
| Molecular formula | C24H25N3O3S |
|---|---|
| Molecular weight | 435.5 g/mol |
| IUPAC name | N-[(2R)-1-(2-morpholin-4-ylanilino)-1-oxo-3-phenylpropan-2-yl]thiophene-2-carboxamide |
| InChIKey | YZLODHPDCSNHTP-HXUWFJFHSA-N |
| SMILES | C1COCCN1C2=CC=CC=C2NC(=O)[C@@H](CC3=CC=CC=C3)NC(=O)C4=CC=CS4 |
Computed by PubChem (NCBI)
Synonyms:
orb1744310