CAS 871096-98-9 is the registry number for 2-(Indolin-1-yl)-1-(4-(naphthalen-2-ylsulfonyl)piperazin-1-yl)ethan-1-one, 98%, 98%. Offered by: Chemat. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg.
2-(2,3-dihydroindol-1-yl)-1-(4-naphthalen-2-ylsulfonylpiperazin-1-yl)ethanone (CAS 871096-98-9) is a chemical compound with the molecular formula C24H25N3O3S and a molecular weight of 435.5 g/mol. IUPAC name: 2-(2,3-dihydroindol-1-yl)-1-(4-naphthalen-2-ylsulfonylpiperazin-1-yl)ethanone. InChIKey: VQLVPXNZVOVLPZ-UHFFFAOYSA-N.
| Molecular formula | C24H25N3O3S |
|---|---|
| Molecular weight | 435.5 g/mol |
| IUPAC name | 2-(2,3-dihydroindol-1-yl)-1-(4-naphthalen-2-ylsulfonylpiperazin-1-yl)ethanone |
| InChIKey | VQLVPXNZVOVLPZ-UHFFFAOYSA-N |
| SMILES | C1CN(C2=CC=CC=C21)CC(=O)N3CCN(CC3)S(=O)(=O)C4=CC5=CC=CC=C5C=C4 |
Computed by PubChem (NCBI)