CAS 2055397-88-9 appears in our catalog under these names: MOZ-IN-2/ 99.89% (existing batch purity), MOZ-IN-2, MOZ-IN-2 - Bio-X â„¢, MOZ-IN-2 99+%, MOZ-IN-2, 99.58%. Offered by: TargetMol, Biosynth, Ambeed, Chemat, MedChemExpress. Available pack sizes: 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 250mg.
N'-(benzenesulfonyl)-2-fluoro-5-pyridazin-4-ylbenzohydrazide (CAS 2055397-88-9) is a chemical compound with the molecular formula C17H13FN4O3S and a molecular weight of 372.4 g/mol. IUPAC name: N'-(benzenesulfonyl)-2-fluoro-5-pyridazin-4-ylbenzohydrazide. InChIKey: WYMCVPPNOFFNGE-UHFFFAOYSA-N.
| Molecular formula | C17H13FN4O3S |
|---|---|
| Molecular weight | 372.4 g/mol |
| IUPAC name | N'-(benzenesulfonyl)-2-fluoro-5-pyridazin-4-ylbenzohydrazide |
| InChIKey | WYMCVPPNOFFNGE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)S(=O)(=O)NNC(=O)C2=C(C=CC(=C2)C3=CN=NC=C3)F |
Computed by PubChem (NCBI)