CAS 1938056-90-6 appears in our catalog under these names: MP07-66/ 97.83% (existing batch purity), MP07–66, MP07-66 97%, 2,2-Diethoxy-N-(4-(hexyloxy)benzyl)ethanamine, 97%, 97%, MP07-66, 99.86%. Offered by: TargetMol, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 10mM (in 1ml dmso).
2,2-diethoxy-N-[(4-hexoxyphenyl)methyl]ethanamine (CAS 1938056-90-6) is a chemical compound with the molecular formula C19H33NO3 and a molecular weight of 323.5 g/mol. IUPAC name: 2,2-diethoxy-N-[(4-hexoxyphenyl)methyl]ethanamine. InChIKey: WBCMPXCRPPCZSO-UHFFFAOYSA-N.
| Molecular formula | C19H33NO3 |
|---|---|
| Molecular weight | 323.5 g/mol |
| IUPAC name | 2,2-diethoxy-N-[(4-hexoxyphenyl)methyl]ethanamine |
| InChIKey | WBCMPXCRPPCZSO-UHFFFAOYSA-N |
| SMILES | CCCCCCOC1=CC=C(C=C1)CNCC(OCC)OCC |
Computed by PubChem (NCBI)