cas: 1263044-81-0 — see every product listed under this CAS number, including other names
MPEG4-Mal 99% (CAS 1263044-81-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A755263-100mg |
| cas | 1263044-81-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 1460.62 Pln | |
| Ambeed | 250mg | 1744.31 Pln | |
| Ambeed | 1g | 3474.25 Pln |
| purity | 99% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A755263 |
3-(2,5-dioxopyrrol-1-yl)-N-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethyl]propanamide (CAS 1263044-81-0) is a chemical compound with the molecular formula C16H26N2O7 and a molecular weight of 358.39 g/mol. IUPAC name: 3-(2,5-dioxopyrrol-1-yl)-N-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethyl]propanamide. InChIKey: DOHTYEHHGXSUJO-UHFFFAOYSA-N.
| Molecular formula | C16H26N2O7 |
|---|---|
| Molecular weight | 358.39 g/mol |
| IUPAC name | 3-(2,5-dioxopyrrol-1-yl)-N-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethyl]propanamide |
| InChIKey | DOHTYEHHGXSUJO-UHFFFAOYSA-N |
| SMILES | COCCOCCOCCOCCNC(=O)CCN1C(=O)C=CC1=O |
Computed by PubChem (NCBI)