cas: 1263044-81-0 — see every product listed under this CAS number, including other names
Mpeg4-Mal, 99%, 99% (CAS 1263044-81-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HRFY-100mg |
| cas | 1263044-81-0 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 309.20 Pln | |
| Chemat | 250mg | 482.00 Pln | |
| Chemat | 1g | 890.00 Pln |
| purity | 99% |
|---|---|
| delivery time | 3 weeks |
3-(2,5-dioxopyrrol-1-yl)-N-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethyl]propanamide (CAS 1263044-81-0) is a chemical compound with the molecular formula C16H26N2O7 and a molecular weight of 358.39 g/mol. IUPAC name: 3-(2,5-dioxopyrrol-1-yl)-N-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethyl]propanamide. InChIKey: DOHTYEHHGXSUJO-UHFFFAOYSA-N.
| Molecular formula | C16H26N2O7 |
|---|---|
| Molecular weight | 358.39 g/mol |
| IUPAC name | 3-(2,5-dioxopyrrol-1-yl)-N-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethyl]propanamide |
| InChIKey | DOHTYEHHGXSUJO-UHFFFAOYSA-N |
| SMILES | COCCOCCOCCOCCNC(=O)CCN1C(=O)C=CC1=O |
Computed by PubChem (NCBI)