CAS 2374703-19-0 appears in our catalog under these names: MR-L2/ 99.84% (existing batch purity), MR–L2, MR-L2, MR-L2, 98.63%. Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg.
2-[3-(4-chloro-3-fluorophenyl)-5-ethyl-1,2,4-triazol-1-yl]-N-[(3,5-dichlorophenyl)methyl]acetamide (CAS 2374703-19-0) is a chemical compound with the molecular formula C19H16Cl3FN4O and a molecular weight of 441.7 g/mol. IUPAC name: 2-[3-(4-chloro-3-fluorophenyl)-5-ethyl-1,2,4-triazol-1-yl]-N-[(3,5-dichlorophenyl)methyl]acetamide. InChIKey: JXACCOKEEPXHCF-UHFFFAOYSA-N.
| Molecular formula | C19H16Cl3FN4O |
|---|---|
| Molecular weight | 441.7 g/mol |
| IUPAC name | 2-[3-(4-chloro-3-fluorophenyl)-5-ethyl-1,2,4-triazol-1-yl]-N-[(3,5-dichlorophenyl)methyl]acetamide |
| InChIKey | JXACCOKEEPXHCF-UHFFFAOYSA-N |
| SMILES | CCC1=NC(=NN1CC(=O)NCC2=CC(=CC(=C2)Cl)Cl)C3=CC(=C(C=C3)Cl)F |
Computed by PubChem (NCBI)