CAS 2803881-11-8 appears in our catalog under these names: MRT-2359/ 98.25% (existing batch purity), MRT–2359, MRT-2359 98%, MRT-2359, 98%, 98%, MRT-2359, 99.98%. Offered by: TargetMol, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg, 1g.
[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]methyl N-[2-fluoro-5-(trifluoromethoxy)phenyl]carbamate (CAS 2803881-11-8) is a chemical compound with the molecular formula C22H17F4N3O6 and a molecular weight of 495.4 g/mol. IUPAC name: [2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]methyl N-[2-fluoro-5-(trifluoromethoxy)phenyl]carbamate. InChIKey: HNTGMIGBGVFOBT-UHFFFAOYSA-N.
| Molecular formula | C22H17F4N3O6 |
|---|---|
| Molecular weight | 495.4 g/mol |
| IUPAC name | [2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]methyl N-[2-fluoro-5-(trifluoromethoxy)phenyl]carbamate |
| InChIKey | HNTGMIGBGVFOBT-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1N2CC3=C(C2=O)C=C(C=C3)COC(=O)NC4=C(C=CC(=C4)OC(F)(F)F)F |
Computed by PubChem (NCBI)