CAS 1263132-08-6 appears in our catalog under these names: MRT-81/ 98.31% (existing batch purity), MRT–81, N-(2-Methyl-5-(3-(3,4,5-trimethoxybenzoyl)thioureido)phenyl)-[1,1'-biphenyl]-4-carboxamide, 95%, 95%, MRT-81, 99.85%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10 mg, 25 mg.
3,4,5-trimethoxy-N-[[4-methyl-3-[(4-phenylbenzoyl)amino]phenyl]carbamothioyl]benzamide (CAS 1263132-08-6) is a chemical compound with the molecular formula C31H29N3O5S and a molecular weight of 555.6 g/mol. IUPAC name: 3,4,5-trimethoxy-N-[[4-methyl-3-[(4-phenylbenzoyl)amino]phenyl]carbamothioyl]benzamide. InChIKey: CTXQODCQOSYYDE-UHFFFAOYSA-N.
| Molecular formula | C31H29N3O5S |
|---|---|
| Molecular weight | 555.6 g/mol |
| IUPAC name | 3,4,5-trimethoxy-N-[[4-methyl-3-[(4-phenylbenzoyl)amino]phenyl]carbamothioyl]benzamide |
| InChIKey | CTXQODCQOSYYDE-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)NC(=S)NC(=O)C2=CC(=C(C(=C2)OC)OC)OC)NC(=O)C3=CC=C(C=C3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)