CAS 1992047-64-9 appears in our catalog under these names: MS023 dihydrochloride/ 99.52% (existing batch purity), MS 023 dihydrochloride, MS023 (dihydrochloride), ≥98%(HPLC), ≥98%(HPLC), MS023 (dihydrochloride), 99.68%, MS023 2HCl, 99+%. Offered by: TargetMol, Biosynth, Chemat, MedChemExpress, Ambeed. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 5 mg, 100 mg, 25 mg.
N'-methyl-N'-[[4-(4-propan-2-yloxyphenyl)-1H-pyrrol-3-yl]methyl]ethane-1,2-diamine;dihydrochloride (CAS 1992047-64-9) is a chemical compound with the molecular formula C17H27Cl2N3O and a molecular weight of 360.3 g/mol. IUPAC name: N'-methyl-N'-[[4-(4-propan-2-yloxyphenyl)-1H-pyrrol-3-yl]methyl]ethane-1,2-diamine;dihydrochloride. InChIKey: HCNXCUFNZWGILO-UHFFFAOYSA-N.
| Molecular formula | C17H27Cl2N3O |
|---|---|
| Molecular weight | 360.3 g/mol |
| IUPAC name | N'-methyl-N'-[[4-(4-propan-2-yloxyphenyl)-1H-pyrrol-3-yl]methyl]ethane-1,2-diamine;dihydrochloride |
| InChIKey | HCNXCUFNZWGILO-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=CC=C(C=C1)C2=CNC=C2CN(C)CCN.Cl.Cl |
Computed by PubChem (NCBI)