cas: 1124381-43-6 — see every product listed under this CAS number, including other names
MSC 2032964A (CAS 1124381-43-6) is a chemical reagent available from Chemat. Available pack sizes: 10mg, 50mg, 100mg, 1mg, 2mg, 5mg, 25mg, 200mg. Offered by: GLPBio, Biosynth, Chemat, MedChemExpress.
| brand | GLPBio |
|---|---|
| catalog number | GC50223-10 |
| cas | 1124381-43-6 |
| size | 10mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| GLPBio | 10mg | 2019.91 Pln | |
| GLPBio | 50mg | 6709.77 Pln | |
| Biosynth | 50mg | price on request | |
| Biosynth | 100mg | price on request | |
| Chemat | 1mg | 510.80 Pln | |
| Chemat | 2mg | 659.60 Pln | |
| Chemat | 5mg | 981.20 Pln | |
| Chemat | 10mg | 1547.60 Pln | |
| Chemat | 25mg | 2478.80 Pln | |
| Chemat | 50mg | 3424.40 Pln | |
| Chemat | 100mg | 4552.40 Pln | |
| Chemat | 200mg | 6112.40 Pln | |
| MedChemExpress | 1 mg | 997.72 Pln | |
| MedChemExpress | 25 mg | 4764.00 Pln | |
| MedChemExpress | 10 mg | 2985.35 Pln | |
| MedChemExpress | 5 mg | 1898.65 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
N-[5-(cyclopropylamino)-7-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyridin-2-yl]pyridine-3-carboxamide (CAS 1124381-43-6) is a chemical compound with the molecular formula C16H13F3N6O and a molecular weight of 362.31 g/mol. IUPAC name: N-[5-(cyclopropylamino)-7-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyridin-2-yl]pyridine-3-carboxamide. InChIKey: XUKGFHHTSUKORV-UHFFFAOYSA-N.
| Molecular formula | C16H13F3N6O |
|---|---|
| Molecular weight | 362.31 g/mol |
| IUPAC name | N-[5-(cyclopropylamino)-7-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyridin-2-yl]pyridine-3-carboxamide |
| InChIKey | XUKGFHHTSUKORV-UHFFFAOYSA-N |
| SMILES | C1CC1NC2=CC(=CC3=NC(=NN23)NC(=O)C4=CN=CC=C4)C(F)(F)F |
Computed by PubChem (NCBI)