CAS 2445185-57-7 appears in our catalog under these names: MSC-4381/ 99.04% (existing batch purity), MCT4–IN–1, MSC-4381 98%, MSC-4381, 99.04% ,, 99.04% ,, MSC-4381, 98.89%. Offered by: TargetMol, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg.
5-[2-[5-chloro-2-[(5-ethoxyquinolin-8-yl)sulfonylamino]phenyl]ethynyl]-4-methoxypyridine-2-carboxylic acid (CAS 2445185-57-7) is a chemical compound with the molecular formula C26H20ClN3O6S and a molecular weight of 538.0 g/mol. IUPAC name: 5-[2-[5-chloro-2-[(5-ethoxyquinolin-8-yl)sulfonylamino]phenyl]ethynyl]-4-methoxypyridine-2-carboxylic acid. InChIKey: FNBUZGRPJLEIMO-UHFFFAOYSA-N.
| Molecular formula | C26H20ClN3O6S |
|---|---|
| Molecular weight | 538.0 g/mol |
| IUPAC name | 5-[2-[5-chloro-2-[(5-ethoxyquinolin-8-yl)sulfonylamino]phenyl]ethynyl]-4-methoxypyridine-2-carboxylic acid |
| InChIKey | FNBUZGRPJLEIMO-UHFFFAOYSA-N |
| SMILES | CCOC1=C2C=CC=NC2=C(C=C1)S(=O)(=O)NC3=C(C=C(C=C3)Cl)C#CC4=CN=C(C=C4OC)C(=O)O |
Computed by PubChem (NCBI)