CAS 2456434-36-7 appears in our catalog under these names: MSU-42011/ 99.04% (existing batch purity), MSU–42011, 6-((3,5-Di-tert-butylphenyl)(isobutyl)amino)nicotinic acid, MSU-42011, 98.43%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 200mg.
6-[3,5-ditert-butyl-N-(2-methylpropyl)anilino]pyridine-3-carboxylic acid (CAS 2456434-36-7) is a chemical compound with the molecular formula C24H34N2O2 and a molecular weight of 382.5 g/mol. IUPAC name: 6-[3,5-ditert-butyl-N-(2-methylpropyl)anilino]pyridine-3-carboxylic acid. InChIKey: VCRGDWUAXDMPKH-UHFFFAOYSA-N.
| Molecular formula | C24H34N2O2 |
|---|---|
| Molecular weight | 382.5 g/mol |
| IUPAC name | 6-[3,5-ditert-butyl-N-(2-methylpropyl)anilino]pyridine-3-carboxylic acid |
| InChIKey | VCRGDWUAXDMPKH-UHFFFAOYSA-N |
| SMILES | CC(C)CN(C1=NC=C(C=C1)C(=O)O)C2=CC(=CC(=C2)C(C)(C)C)C(C)(C)C |
Computed by PubChem (NCBI)