CAS 1885900-35-5 appears in our catalog under these names: Antiproliferative agent-14, 98%, MT189/ 98.67% (existing batch purity), Antiproliferative agent–14, Antiproliferative agent-14 99%, Antiproliferative agent-14. Offered by: AmBeed, TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 5mg, 1mg, 10mg, 25mg, 50mg, 100mg, 500mg, 250mg.
2-[6-fluoro-3-[(4-methoxyphenyl)methylamino]imidazo[1,2-a]pyridin-2-yl]phenol (CAS 1885900-35-5) is a chemical compound with the molecular formula C21H18FN3O2 and a molecular weight of 363.4 g/mol. IUPAC name: 2-[6-fluoro-3-[(4-methoxyphenyl)methylamino]imidazo[1,2-a]pyridin-2-yl]phenol. InChIKey: QBNMSKFVSPKNSV-UHFFFAOYSA-N.
| Molecular formula | C21H18FN3O2 |
|---|---|
| Molecular weight | 363.4 g/mol |
| IUPAC name | 2-[6-fluoro-3-[(4-methoxyphenyl)methylamino]imidazo[1,2-a]pyridin-2-yl]phenol |
| InChIKey | QBNMSKFVSPKNSV-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)CNC2=C(N=C3N2C=C(C=C3)F)C4=CC=CC=C4O |
Computed by PubChem (NCBI)