Products 2499962-58-0
CAS 2499962-58-0 appears in our catalog under these names: MTK458/ 98.36% (existing batch purity), MTK458, MTK458 98%, MTK458, 99.45%. Offered by: TargetMol, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 100mg, 25mg, 10mM (in 1ml dmso), 50mg, 250mg.
N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]-6-(trifluoromethyl)-7H-pyrrolo[2,3-d]pyrimidin-4-amine (CAS 2499962-58-0) is a chemical compound with the molecular formula C17H15F3N4 and a molecular weight of 332.32 g/mol. IUPAC name: N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]-6-(trifluoromethyl)-7H-pyrrolo[2,3-d]pyrimidin-4-amine. InChIKey: JOIONRWKOGDQOG-CYBMUJFWSA-N.
| Molecular formula | C17H15F3N4 |
|---|---|
| Molecular weight | 332.32 g/mol |
| IUPAC name | N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]-6-(trifluoromethyl)-7H-pyrrolo[2,3-d]pyrimidin-4-amine |
| InChIKey | JOIONRWKOGDQOG-CYBMUJFWSA-N |
| SMILES | C1C[C@H](C2=CC=CC=C2C1)NC3=NC=NC4=C3C=C(N4)C(F)(F)F |
Computed by PubChem (NCBI)