CAS 1005264-47-0 appears in our catalog under these names: MX69/ 97.27% (existing batch purity), MX69, MX-69, >98.0%(HPLC)(T), MX69 99%, 4-(8-(N-(3,4-Dimethylphenyl)sulfamoyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl)benzoic acid, 99%, 99%. Offered by: TargetMol, GLPBio, TCI, Biosynth, Ambeed. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 1mg, 10 mg.
4-[8-[(3,4-dimethylphenyl)sulfamoyl]-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl]benzoic acid (CAS 1005264-47-0) is a chemical compound with the molecular formula C27H26N2O4S and a molecular weight of 474.6 g/mol. IUPAC name: 4-[8-[(3,4-dimethylphenyl)sulfamoyl]-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl]benzoic acid. InChIKey: XCBONKHCCRJMNW-UHFFFAOYSA-N.
| Molecular formula | C27H26N2O4S |
|---|---|
| Molecular weight | 474.6 g/mol |
| IUPAC name | 4-[8-[(3,4-dimethylphenyl)sulfamoyl]-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl]benzoic acid |
| InChIKey | XCBONKHCCRJMNW-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)NS(=O)(=O)C2=CC3=C(C=C2)NC(C4C3C=CC4)C5=CC=C(C=C5)C(=O)O)C |
Computed by PubChem (NCBI)