CAS 3008262-76-5 appears in our catalog under these names: MY–1076, MY-1076/ 99.57% (existing batch purity), MY-1076 98%, MY-1076, 99.32%, (E)-N-(3-Hydroxy-4-methoxybenzyl)-N,3-bis(3,4,5-trimethoxyphenyl)acrylamide, 98%, 98%. Offered by: GLPBio, TargetMol, Ambeed, MedChemExpress, Chemat. Available pack sizes: 5mg, 1mg, 10mg, 25mg, 50mg, 100mg, 250mg, 100 mg.
(E)-N-[(3-hydroxy-4-methoxyphenyl)methyl]-N,3-bis(3,4,5-trimethoxyphenyl)prop-2-enamide (CAS 3008262-76-5) is a chemical compound with the molecular formula C29H33NO9 and a molecular weight of 539.6 g/mol. IUPAC name: (E)-N-[(3-hydroxy-4-methoxyphenyl)methyl]-N,3-bis(3,4,5-trimethoxyphenyl)prop-2-enamide. InChIKey: UFLBJFMTHUAWBY-PKNBQFBNSA-N.
| Molecular formula | C29H33NO9 |
|---|---|
| Molecular weight | 539.6 g/mol |
| IUPAC name | (E)-N-[(3-hydroxy-4-methoxyphenyl)methyl]-N,3-bis(3,4,5-trimethoxyphenyl)prop-2-enamide |
| InChIKey | UFLBJFMTHUAWBY-PKNBQFBNSA-N |
| SMILES | COC1=C(C=C(C=C1)CN(C2=CC(=C(C(=C2)OC)OC)OC)C(=O)/C=C/C3=CC(=C(C(=C3)OC)OC)OC)O |
Computed by PubChem (NCBI)