CAS 1377239-83-2 appears in our catalog under these names: Macozinone/ 99.5% (existing batch purity), PBTZ169, Macozinone 97%, PBTZ169, 98%, 98%, Macozinone, 98.46%. Offered by: TargetMol, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 0,5g.
2-[4-(cyclohexylmethyl)piperazin-1-yl]-8-nitro-6-(trifluoromethyl)-1,3-benzothiazin-4-one (CAS 1377239-83-2) is a chemical compound with the molecular formula C20H23F3N4O3S and a molecular weight of 456.5 g/mol. IUPAC name: 2-[4-(cyclohexylmethyl)piperazin-1-yl]-8-nitro-6-(trifluoromethyl)-1,3-benzothiazin-4-one. InChIKey: BJDZBXGJNBMCAV-UHFFFAOYSA-N.
| Molecular formula | C20H23F3N4O3S |
|---|---|
| Molecular weight | 456.5 g/mol |
| IUPAC name | 2-[4-(cyclohexylmethyl)piperazin-1-yl]-8-nitro-6-(trifluoromethyl)-1,3-benzothiazin-4-one |
| InChIKey | BJDZBXGJNBMCAV-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)CN2CCN(CC2)C3=NC(=O)C4=C(S3)C(=CC(=C4)C(F)(F)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)