cas: 1433997-01-3 — see every product listed under this CAS number, including other names
Mal-PEG2-NHS ester 95% (CAS 1433997-01-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A584523-100mg |
| cas | 1433997-01-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 292.50 Pln | |
| Ambeed | 250mg | 442.69 Pln | |
| Ambeed | 1g | 1054.56 Pln | |
| Ambeed | 5g | 3418.62 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A584523 |
(2,5-dioxopyrrolidin-1-yl) 3-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]propanoate (CAS 1433997-01-3) is a chemical compound with the molecular formula C15H18N2O8 and a molecular weight of 354.31 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]propanoate. InChIKey: KMEJZQCDHANYJV-UHFFFAOYSA-N.
| Molecular formula | C15H18N2O8 |
|---|---|
| Molecular weight | 354.31 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]propanoate |
| InChIKey | KMEJZQCDHANYJV-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)OC(=O)CCOCCOCCN2C(=O)C=CC2=O |
Computed by PubChem (NCBI)