cas: 518044-35-4 — see every product listed under this CAS number, including other names
Mal-PEG3-Boc (CAS 518044-35-4) is a chemical reagent available from Chemat. Available pack sizes: 2mg, 5mg, 10mg, 25mg. Offered by: TargetMol.
| brand | TargetMol |
|---|---|
| catalog number | T15986-2mg |
| cas | 518044-35-4 |
| size | 2mg |
| brand | size | price | |
|---|---|---|---|
| TargetMol | 2mg | 399.00 Pln | |
| TargetMol | 5mg | 499.07 Pln | |
| TargetMol | 10mg | 638.26 Pln | |
| TargetMol | 25mg | 910.49 Pln |
| purity | No data |
|---|---|
| delivery time | approx. 26 days |
Tert-butyl 3-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethoxy]propanoate (CAS 518044-35-4) is a chemical compound with the molecular formula C17H27NO7 and a molecular weight of 357.4 g/mol. IUPAC name: tert-butyl 3-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethoxy]propanoate. InChIKey: GBAIKTRBCFEELB-UHFFFAOYSA-N.
| Molecular formula | C17H27NO7 |
|---|---|
| Molecular weight | 357.4 g/mol |
| IUPAC name | tert-butyl 3-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethoxy]propanoate |
| InChIKey | GBAIKTRBCFEELB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CCOCCOCCOCCN1C(=O)C=CC1=O |
Computed by PubChem (NCBI)