Products 518044-35-4
CAS 518044-35-4 appears in our catalog under these names: Mal-peg3-t-butyl ester, 95%, Mal-PEG3-Boc, Mal–PEG3–Boc, Mal-PEG3-Boc 97%, tert-Butyl 3-(2-(2-(2-(2,5-dioxo-2,5-dihydro-1H-pyrrol-1-yl)ethoxy)ethoxy)ethoxy)propanoate, 97%, 97%. Offered by: Combi-blocks, TargetMol, GLPBio, Ambeed, Chemat. Available pack sizes: 100mg, 500mg, 2mg, 5mg, 10mg, 25mg, 250mg, 1g.
Tert-butyl 3-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethoxy]propanoate (CAS 518044-35-4) is a chemical compound with the molecular formula C17H27NO7 and a molecular weight of 357.4 g/mol. IUPAC name: tert-butyl 3-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethoxy]propanoate. InChIKey: GBAIKTRBCFEELB-UHFFFAOYSA-N.
| Molecular formula | C17H27NO7 |
|---|---|
| Molecular weight | 357.4 g/mol |
| IUPAC name | tert-butyl 3-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethoxy]propanoate |
| InChIKey | GBAIKTRBCFEELB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CCOCCOCCOCCN1C(=O)C=CC1=O |
Computed by PubChem (NCBI)