cas: 1818294-46-0 — see every product listed under this CAS number, including other names
Mal-PEG8-acid 95% (CAS 1818294-46-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A755603-100mg |
| cas | 1818294-46-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 809.81 Pln | |
| Ambeed | 250mg | 1282.62 Pln | |
| Ambeed | 1g | 3351.88 Pln | |
| Ambeed | 5g | 9921.19 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A755603 |
3-[2-[2-[2-[2-[2-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid (CAS 1818294-46-0) is a chemical compound with the molecular formula C23H39NO12 and a molecular weight of 521.6 g/mol. IUPAC name: 3-[2-[2-[2-[2-[2-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid. InChIKey: KLZPPWOSICDUKQ-UHFFFAOYSA-N.
| Molecular formula | C23H39NO12 |
|---|---|
| Molecular weight | 521.6 g/mol |
| IUPAC name | 3-[2-[2-[2-[2-[2-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid |
| InChIKey | KLZPPWOSICDUKQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=O)N(C1=O)CCOCCOCCOCCOCCOCCOCCOCCOCCC(=O)O |
Computed by PubChem (NCBI)