cas: 1431291-44-9 — see every product listed under this CAS number, including other names
Mal-amido-PEG2-TFP ester, 97% (CAS 1431291-44-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F987033-100MG |
| cas | 1431291-44-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 435.28 Pln | |
| Fluorochem | 250mg | 690.40 Pln | |
| Fluorochem | 1g | 1903.51 Pln | |
| Fluorochem | 5g | 7057.95 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
(2,3,5,6-tetrafluorophenyl) 3-[2-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethoxy]ethoxy]propanoate (CAS 1431291-44-9) is a chemical compound with the molecular formula C20H20F4N2O7 and a molecular weight of 476.4 g/mol. IUPAC name: (2,3,5,6-tetrafluorophenyl) 3-[2-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethoxy]ethoxy]propanoate. InChIKey: HHXSYLTYQVHXMA-UHFFFAOYSA-N.
| Molecular formula | C20H20F4N2O7 |
|---|---|
| Molecular weight | 476.4 g/mol |
| IUPAC name | (2,3,5,6-tetrafluorophenyl) 3-[2-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethoxy]ethoxy]propanoate |
| InChIKey | HHXSYLTYQVHXMA-UHFFFAOYSA-N |
| SMILES | C1=CC(=O)N(C1=O)CCC(=O)NCCOCCOCCC(=O)OC2=C(C(=CC(=C2F)F)F)F |
Computed by PubChem (NCBI)