Products 1431291-44-9
CAS 1431291-44-9 appears in our catalog under these names: Mal-amido-peg2-tfp ester, 95%, Mal–amido–PEG2–TFP ester, mal-PEG(2)-TFP, Mal-amido-PEG2-TFP ester, Mal-amido-PEG2-TFP ester, 98.68%. Offered by: Combi-blocks, GLPBio, Iris Biotech, Biosynth, MedChemExpress. Available pack sizes: 250mg, 1g, 100mg, 500mg, 1000mg, 100 mg, 250 mg, 50 mg.
(2,3,5,6-tetrafluorophenyl) 3-[2-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethoxy]ethoxy]propanoate (CAS 1431291-44-9) is a chemical compound with the molecular formula C20H20F4N2O7 and a molecular weight of 476.4 g/mol. IUPAC name: (2,3,5,6-tetrafluorophenyl) 3-[2-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethoxy]ethoxy]propanoate. InChIKey: HHXSYLTYQVHXMA-UHFFFAOYSA-N.
| Molecular formula | C20H20F4N2O7 |
|---|---|
| Molecular weight | 476.4 g/mol |
| IUPAC name | (2,3,5,6-tetrafluorophenyl) 3-[2-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethoxy]ethoxy]propanoate |
| InChIKey | HHXSYLTYQVHXMA-UHFFFAOYSA-N |
| SMILES | C1=CC(=O)N(C1=O)CCC(=O)NCCOCCOCCC(=O)OC2=C(C(=CC(=C2F)F)F)F |
Computed by PubChem (NCBI)