CAS 676-46-0 appears in our catalog under these names: DL-Malic acid disodium salt, 95%, Maleate, 0.2M buffer soln., pH , DL-Hydroxysuccinic acid sodium, Disodium DL-Malate, >98.0%(T), DL-Malic acid disodium salt, 98.00%. Offered by: Combi-blocks, Thermo Scientific (Alfa Aesar), Biosynth, TCI, Chemat. Available pack sizes: 100g, 500g, 1kg, 5g, 25g, 250ml, 500ml, 5kg.
Disodium;2-hydroxybutanedioate (CAS 676-46-0) is a chemical compound with the molecular formula C4H4Na2O5 and a molecular weight of 178.05 g/mol. IUPAC name: disodium;2-hydroxybutanedioate. InChIKey: WPUMTJGUQUYPIV-UHFFFAOYSA-L.
| Molecular formula | C4H4Na2O5 |
|---|---|
| Molecular weight | 178.05 g/mol |
| IUPAC name | disodium;2-hydroxybutanedioate |
| InChIKey | WPUMTJGUQUYPIV-UHFFFAOYSA-L |
| SMILES | C(C(C(=O)[O-])O)C(=O)[O-].[Na+].[Na+] |
Computed by PubChem (NCBI)