CAS 63474-37-3 appears in our catalog under these names: Disodium dl-malate hydrate, 98%, Malic acid disodium hydrate, D,L-Malate sodium hydrate, Malic acid (disodium hydrate), 98.0%. Offered by: Combi-blocks, GLPBio, Biosynth, MedChemExpress. Available pack sizes: 1g, 100g, 25g, 5g, 25mg, 10mg, 50mg, 250mg.
Disodium;2-hydroxybutanedioate (CAS 63474-37-3) is a chemical compound with the molecular formula C4H4Na2O5 and a molecular weight of 178.05 g/mol. IUPAC name: disodium;2-hydroxybutanedioate. InChIKey: WPUMTJGUQUYPIV-UHFFFAOYSA-L.
| Molecular formula | C4H4Na2O5 |
|---|---|
| Molecular weight | 178.05 g/mol |
| IUPAC name | disodium;2-hydroxybutanedioate |
| InChIKey | WPUMTJGUQUYPIV-UHFFFAOYSA-L |
| SMILES | C(C(C(=O)[O-])O)C(=O)[O-].[Na+].[Na+] |
Computed by PubChem (NCBI)