CAS 2070014-78-5 appears in our catalog under these names: PF–2545920 hydrochloridePF–2545920 hydrochloride (Mardepodect hydrochloride0, Mardepodect hydrochloride/ 95.1% (existing batch purity), Mardepodect hydrochloride, Mardepodect (hydrochloride), Mardepodect (hydrochloride), 99.94%. Offered by: GLPBio, TargetMol, Biosynth, Chemat, MedChemExpress. Available pack sizes: 5mg, 2mg, 25mg, 10mg, 50mg, 100mg, 1mg, 50 mg.
2-[[4-(1-methyl-4-pyridin-4-ylpyrazol-3-yl)phenoxy]methyl]quinoline;hydrochloride (CAS 2070014-78-5) is a chemical compound with the molecular formula C25H21ClN4O and a molecular weight of 428.9 g/mol. IUPAC name: 2-[[4-(1-methyl-4-pyridin-4-ylpyrazol-3-yl)phenoxy]methyl]quinoline;hydrochloride. InChIKey: BDHTXAXWOXYUDG-UHFFFAOYSA-N.
| Molecular formula | C25H21ClN4O |
|---|---|
| Molecular weight | 428.9 g/mol |
| IUPAC name | 2-[[4-(1-methyl-4-pyridin-4-ylpyrazol-3-yl)phenoxy]methyl]quinoline;hydrochloride |
| InChIKey | BDHTXAXWOXYUDG-UHFFFAOYSA-N |
| SMILES | CN1C=C(C(=N1)C2=CC=C(C=C2)OCC3=NC4=CC=CC=C4C=C3)C5=CC=NC=C5.Cl |
Computed by PubChem (NCBI)