CAS 898562-94-2 appears in our catalog under these names: Mardepodect/ 98.82% (existing batch purity), PF-2545920, Mardepodect, Mardepodect 99%, 2-[(4-(1-Methyl-4-(pyridin-4-yl)-1H-pyrazol-3-yl)phenoxy)methyl]quinoline, 99%, 99%. Offered by: TargetMol, Chemat, Biosynth, Ambeed, MedChemExpress. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg.
2-[[4-(1-methyl-4-pyridin-4-ylpyrazol-3-yl)phenoxy]methyl]quinoline (CAS 898562-94-2) is a chemical compound with the molecular formula C25H20N4O and a molecular weight of 392.5 g/mol. IUPAC name: 2-[[4-(1-methyl-4-pyridin-4-ylpyrazol-3-yl)phenoxy]methyl]quinoline. InChIKey: AZEXWHKOMMASPA-UHFFFAOYSA-N.
| Molecular formula | C25H20N4O |
|---|---|
| Molecular weight | 392.5 g/mol |
| IUPAC name | 2-[[4-(1-methyl-4-pyridin-4-ylpyrazol-3-yl)phenoxy]methyl]quinoline |
| InChIKey | AZEXWHKOMMASPA-UHFFFAOYSA-N |
| SMILES | CN1C=C(C(=N1)C2=CC=C(C=C2)OCC3=NC4=CC=CC=C4C=C3)C5=CC=NC=C5 |
Computed by PubChem (NCBI)