CAS 956274-94-5 appears in our catalog under these names: Mavatrep, Mavatrep/ 98.01% (existing batch purity), Mavatrep 99%, Mavatrep, 99.67%, Mavatrep (Standard). Offered by: GLPBio, TargetMol, Ambeed, MedChemExpress, Chemat. Available pack sizes: 5mg, 1mg, 10mg, 25mg, 50mg, 100mg, 200mg, 10mM (in 1ml dmso).
2-[2-[2-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]-3H-benzimidazol-5-yl]phenyl]propan-2-ol (CAS 956274-94-5) is a chemical compound with the molecular formula C25H21F3N2O and a molecular weight of 422.4 g/mol. IUPAC name: 2-[2-[2-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]-3H-benzimidazol-5-yl]phenyl]propan-2-ol. InChIKey: ORDHXXHTBUZRCN-NTEUORMPSA-N.
| Molecular formula | C25H21F3N2O |
|---|---|
| Molecular weight | 422.4 g/mol |
| IUPAC name | 2-[2-[2-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]-3H-benzimidazol-5-yl]phenyl]propan-2-ol |
| InChIKey | ORDHXXHTBUZRCN-NTEUORMPSA-N |
| SMILES | CC(C)(C1=CC=CC=C1C2=CC3=C(C=C2)N=C(N3)/C=C/C4=CC=C(C=C4)C(F)(F)F)O |
Computed by PubChem (NCBI)