CAS 667463-95-8 appears in our catalog under these names: MeBIO/ 98.84% (existing batch purity), MeBIO, Me6BIO, (2Z,3E)-6'-Bromo-3-(hydroxyimino)-1'-methyl-[2,3'-biindolinylidene]-2'-one, 97%, 97%, MeBIO, 98.0%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 10 mg.
6-bromo-1-methyl-3-(3-nitroso-1H-indol-2-yl)indol-2-ol (CAS 667463-95-8) is a chemical compound with the molecular formula C17H12BrN3O2 and a molecular weight of 370.2 g/mol. IUPAC name: 6-bromo-1-methyl-3-(3-nitroso-1H-indol-2-yl)indol-2-ol. InChIKey: PIDGGJYETVQYET-UHFFFAOYSA-N.
| Molecular formula | C17H12BrN3O2 |
|---|---|
| Molecular weight | 370.2 g/mol |
| IUPAC name | 6-bromo-1-methyl-3-(3-nitroso-1H-indol-2-yl)indol-2-ol |
| InChIKey | PIDGGJYETVQYET-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=CC(=C2)Br)C(=C1O)C3=C(C4=CC=CC=C4N3)N=O |
Computed by PubChem (NCBI)