CAS 101396-46-7 appears in our catalog under these names: Mequitamium/ 98.51% (existing batch purity), Mequitamium. Offered by: TargetMol, Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg.
10-[(1-methyl-1-azoniabicyclo[2.2.2]octan-3-yl)methyl]phenothiazine (CAS 101396-46-7) is a chemical compound with the molecular formula C21H25N2S+ and a molecular weight of 337.5 g/mol. IUPAC name: 10-[(1-methyl-1-azoniabicyclo[2.2.2]octan-3-yl)methyl]phenothiazine. InChIKey: LRHZGVSONLULIX-UHFFFAOYSA-N.
| Molecular formula | C21H25N2S+ |
|---|---|
| Molecular weight | 337.5 g/mol |
| IUPAC name | 10-[(1-methyl-1-azoniabicyclo[2.2.2]octan-3-yl)methyl]phenothiazine |
| InChIKey | LRHZGVSONLULIX-UHFFFAOYSA-N |
| SMILES | C[N+]12CCC(CC1)C(C2)CN3C4=CC=CC=C4SC5=CC=CC=C53 |
Computed by PubChem (NCBI)