CAS 855516-31-3 appears in our catalog under these names: Mesityl(p-tolyl)iodonium tetrafluoroborate, 97%, 97%, Mesityl(p-tolyl)iodonium tetrafluoroborate, 97%. Offered by: Chemat, Ambeed. Available pack sizes: 250mg, 1g, 5g, 10g.
(4-methylphenyl)-(2,4,6-trimethylphenyl)iodanium tetrafluoroborate (CAS 855516-31-3) is a chemical compound with the molecular formula C16H18BF4I and a molecular weight of 424.0 g/mol. IUPAC name: (4-methylphenyl)-(2,4,6-trimethylphenyl)iodanium tetrafluoroborate. InChIKey: LHWJLNWENDSGFA-UHFFFAOYSA-N.
| Molecular formula | C16H18BF4I |
|---|---|
| Molecular weight | 424.0 g/mol |
| IUPAC name | (4-methylphenyl)-(2,4,6-trimethylphenyl)iodanium tetrafluoroborate |
| InChIKey | LHWJLNWENDSGFA-UHFFFAOYSA-N |
| SMILES | [B-](F)(F)(F)F.CC1=CC=C(C=C1)[I+]C2=C(C=C(C=C2C)C)C |
Computed by PubChem (NCBI)