cas: 300345-76-0 — see every product listed under this CAS number, including other names
Methanesulfonamide, N-[(1S,2S)-2-amino-1,2-diphenylethyl]-, 98%, 98% (CAS 300345-76-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114BJA-250mg |
| cas | 300345-76-0 |
| size | 250mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 93.20 Pln | |
| Chemat | 1g | 174.80 Pln | |
| Chemat | 5g | 573.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
N-[(1S,2S)-2-amino-1,2-diphenylethyl]methanesulfonamide (CAS 300345-76-0) is a chemical compound with the molecular formula C15H18N2O2S and a molecular weight of 290.4 g/mol. IUPAC name: N-[(1S,2S)-2-amino-1,2-diphenylethyl]methanesulfonamide. InChIKey: FSRRNSLQEDUDTP-GJZGRUSLSA-N.
| Molecular formula | C15H18N2O2S |
|---|---|
| Molecular weight | 290.4 g/mol |
| IUPAC name | N-[(1S,2S)-2-amino-1,2-diphenylethyl]methanesulfonamide |
| InChIKey | FSRRNSLQEDUDTP-GJZGRUSLSA-N |
| SMILES | CS(=O)(=O)N[C@@H](C1=CC=CC=C1)[C@H](C2=CC=CC=C2)N |
Computed by PubChem (NCBI)