Products 326023-20-5
CAS 326023-20-5 appears in our catalog under these names: 3-Amino-n-(2,4-dimethylphenyl)-4-methylbenzene-1-sulfonamide, 95%, 3-Amino-N-(2,4-dimethylphenyl)-4-methylbenzene-1-sulfonamide. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
3-amino-N-(2,4-dimethylphenyl)-4-methylbenzenesulfonamide (CAS 326023-20-5) is a chemical compound with the molecular formula C15H18N2O2S and a molecular weight of 290.4 g/mol. IUPAC name: 3-amino-N-(2,4-dimethylphenyl)-4-methylbenzenesulfonamide. InChIKey: HHUKHWAZKAVOPN-UHFFFAOYSA-N.
| Molecular formula | C15H18N2O2S |
|---|---|
| Molecular weight | 290.4 g/mol |
| IUPAC name | 3-amino-N-(2,4-dimethylphenyl)-4-methylbenzenesulfonamide |
| InChIKey | HHUKHWAZKAVOPN-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)NS(=O)(=O)C2=CC(=C(C=C2)C)N)C |
Computed by PubChem (NCBI)