cas: 871360-40-6 — see every product listed under this CAS number, including other names
Methanesulfonamide,N-[2-[(4R)-4,5-dihydro-4-(1-methylethyl)-2-oxazolyl]-6-methylphenyl]-, 98%, 98% (CAS 871360-40-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12JGOZ-100mg |
| cas | 871360-40-6 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 1005.20 Pln | |
| Chemat | 250mg | 1634.00 Pln | |
| Chemat | 1g | 3198.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
N-[2-methyl-6-[(4R)-4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]methanesulfonamide (CAS 871360-40-6) is a chemical compound with the molecular formula C14H20N2O3S and a molecular weight of 296.39 g/mol. IUPAC name: N-[2-methyl-6-[(4R)-4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]methanesulfonamide. InChIKey: KCLDECJIUSCXOX-LBPRGKRZSA-N.
| Molecular formula | C14H20N2O3S |
|---|---|
| Molecular weight | 296.39 g/mol |
| IUPAC name | N-[2-methyl-6-[(4R)-4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]methanesulfonamide |
| InChIKey | KCLDECJIUSCXOX-LBPRGKRZSA-N |
| SMILES | CC1=C(C(=CC=C1)C2=N[C@@H](CO2)C(C)C)NS(=O)(=O)C |
Computed by PubChem (NCBI)