CAS 1142210-17-0 appears in our catalog under these names: 2-(1-[(2,4-Dimethyl-1,3-thiazol-5-yl)carbonyl]piperidin-4-yl)propanoic acid, 95%, 2-(1-(2,4-Dimethylthiazole-5-carbonyl)piperidin-4-yl)propanoic acid, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
2-[1-(2,4-dimethyl-1,3-thiazole-5-carbonyl)piperidin-4-yl]propanoic acid (CAS 1142210-17-0) is a chemical compound with the molecular formula C14H20N2O3S and a molecular weight of 296.39 g/mol. IUPAC name: 2-[1-(2,4-dimethyl-1,3-thiazole-5-carbonyl)piperidin-4-yl]propanoic acid. InChIKey: JTABEIOXUSULHN-UHFFFAOYSA-N.
| Molecular formula | C14H20N2O3S |
|---|---|
| Molecular weight | 296.39 g/mol |
| IUPAC name | 2-[1-(2,4-dimethyl-1,3-thiazole-5-carbonyl)piperidin-4-yl]propanoic acid |
| InChIKey | JTABEIOXUSULHN-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=N1)C)C(=O)N2CCC(CC2)C(C)C(=O)O |
Computed by PubChem (NCBI)