cas: 53823-46-4 — see every product listed under this CAS number, including other names
Methanesulfonamide,N-(5-amino-2,4-dimethylphenyl)-1,1,1-trifluoro-, 95%, 95% (CAS 53823-46-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114AR7-100mg |
| cas | 53823-46-4 |
| size | 100mg |
| availability | 1.8g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 1096.40 Pln | |
| Chemat | 250mg | 1782.80 Pln | |
| Chemat | 1g | 5574.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
N-(5-amino-2,4-dimethylphenyl)-1,1,1-trifluoromethanesulfonamide (CAS 53823-46-4) is a chemical compound with the molecular formula C9H11F3N2O2S and a molecular weight of 268.26 g/mol. IUPAC name: N-(5-amino-2,4-dimethylphenyl)-1,1,1-trifluoromethanesulfonamide. InChIKey: MVVQDQQIFUIPRT-UHFFFAOYSA-N.
| Molecular formula | C9H11F3N2O2S |
|---|---|
| Molecular weight | 268.26 g/mol |
| IUPAC name | N-(5-amino-2,4-dimethylphenyl)-1,1,1-trifluoromethanesulfonamide |
| InChIKey | MVVQDQQIFUIPRT-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1N)NS(=O)(=O)C(F)(F)F)C |
Computed by PubChem (NCBI)