CAS 304646-59-1 is the registry number for N1-Ethyl-4-trifluoromethanesulfonyl-benzene-1,2-diamine, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
1-N-ethyl-4-(trifluoromethylsulfonyl)benzene-1,2-diamine (CAS 304646-59-1) is a chemical compound with the molecular formula C9H11F3N2O2S and a molecular weight of 268.26 g/mol. IUPAC name: 1-N-ethyl-4-(trifluoromethylsulfonyl)benzene-1,2-diamine. InChIKey: ZMFHNBBXTFOMNX-UHFFFAOYSA-N.
| Molecular formula | C9H11F3N2O2S |
|---|---|
| Molecular weight | 268.26 g/mol |
| IUPAC name | 1-N-ethyl-4-(trifluoromethylsulfonyl)benzene-1,2-diamine |
| InChIKey | ZMFHNBBXTFOMNX-UHFFFAOYSA-N |
| SMILES | CCNC1=C(C=C(C=C1)S(=O)(=O)C(F)(F)F)N |
Computed by PubChem (NCBI)