cas: 99281-88-6 — see every product listed under this CAS number, including other names
Methyl (E)-4-aminobut-2-enoate 2,2,2-trifluoroacetate, 95%, 95% (CAS 99281-88-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IMPD-100mg |
| cas | 99281-88-6 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 477.20 Pln | |
| Chemat | 250mg | 750.80 Pln | |
| Chemat | 1g | 1442.00 Pln | |
| Chemat | 5g | 4197.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Methyl (E)-4-aminobut-2-enoate;2,2,2-trifluoroacetic acid (CAS 99281-88-6) is a chemical compound with the molecular formula C7H10F3NO4 and a molecular weight of 229.15 g/mol. IUPAC name: methyl (E)-4-aminobut-2-enoate;2,2,2-trifluoroacetic acid. InChIKey: QOPUSJRSVLGGIR-SQQVDAMQSA-N.
| Molecular formula | C7H10F3NO4 |
|---|---|
| Molecular weight | 229.15 g/mol |
| IUPAC name | methyl (E)-4-aminobut-2-enoate;2,2,2-trifluoroacetic acid |
| InChIKey | QOPUSJRSVLGGIR-SQQVDAMQSA-N |
| SMILES | COC(=O)/C=C/CN.C(=O)(C(F)(F)F)O |
Computed by PubChem (NCBI)