CAS 99281-88-6 appears in our catalog under these names: 2-Butenoic acid, 4-amino-, methyl ester, (e)-, trifluoroacetate, 95%, (E)–Methyl 4–aminobut–2–enoate 2,2,2–trifluoroacetate, Methyl (E)-4-aminobut-2-enoate 2,2,2-trifluoroacetate, 95%, 95%. Offered by: Combi-blocks, GLPBio, Chemat. Available pack sizes: 1g, 5g, 250mg, 100mg, 50mg.
Methyl (E)-4-aminobut-2-enoate;2,2,2-trifluoroacetic acid (CAS 99281-88-6) is a chemical compound with the molecular formula C7H10F3NO4 and a molecular weight of 229.15 g/mol. IUPAC name: methyl (E)-4-aminobut-2-enoate;2,2,2-trifluoroacetic acid. InChIKey: QOPUSJRSVLGGIR-SQQVDAMQSA-N.
| Molecular formula | C7H10F3NO4 |
|---|---|
| Molecular weight | 229.15 g/mol |
| IUPAC name | methyl (E)-4-aminobut-2-enoate;2,2,2-trifluoroacetic acid |
| InChIKey | QOPUSJRSVLGGIR-SQQVDAMQSA-N |
| SMILES | COC(=O)/C=C/CN.C(=O)(C(F)(F)F)O |
Computed by PubChem (NCBI)