Methyl (S)-2,3-diazabicyclo[3.1.1]heptane-4-carboxylate hydrochloride, 95%
cas: 3104671-22-6 — see every product listed under this CAS number, including other names
Methyl (S)-2,3-diazabicyclo[3.1.1]heptane-4-carboxylate hydrochloride, 95% (CAS 3104671-22-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A2922993-100mg |
| cas | 3104671-22-6 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 381.50 Pln | |
| Ambeed | 250mg | 693.00 Pln | |
| Ambeed | 1g | 1471.75 Pln | |
| Ambeed | 5g | 3574.38 Pln | |
| Ambeed | 10g | 6372.31 Pln | |
| Ambeed | 25g | 13147.44 Pln | |
| BLDpharm | 100mg | 408.77 Pln | |
| BLDpharm | 250mg | 741.99 Pln | |
| BLDpharm | 1g | 1580.58 Pln | |
| BLDpharm | 5g | 3846.45 Pln | |
| BLDpharm | 10g | 6867.61 Pln | |
| BLDpharm | 25g | 14170.59 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
Methyl (4S)-2,3-diazabicyclo[3.1.1]heptane-4-carboxylate;hydrochloride (CAS 3104671-22-6) is a chemical compound with the molecular formula C7H13ClN2O2 and a molecular weight of 192.64 g/mol. IUPAC name: methyl (4S)-2,3-diazabicyclo[3.1.1]heptane-4-carboxylate;hydrochloride. InChIKey: XQAWJFWBRKHNPS-MMYXBGEXSA-N.
| Molecular formula | C7H13ClN2O2 |
|---|---|
| Molecular weight | 192.64 g/mol |
| IUPAC name | methyl (4S)-2,3-diazabicyclo[3.1.1]heptane-4-carboxylate;hydrochloride |
| InChIKey | XQAWJFWBRKHNPS-MMYXBGEXSA-N |
| SMILES | COC(=O)[C@@H]1C2CC(C2)NN1.Cl |
Computed by PubChem (NCBI)