Methyl (S)-2,3-diazabicyclo[3.1.1]heptane-4-carboxylate hydrochloride, 98%
cas: 3104671-22-6 — see every product listed under this CAS number, including other names
Methyl (S)-2,3-diazabicyclo[3.1.1]heptane-4-carboxylate hydrochloride, 98% (CAS 3104671-22-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 50mg. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch1H209K-100mg |
| cas | 3104671-22-6 |
| size | 100mg |
| availability | 20g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 232.40 Pln | |
| Chemat | 250mg | 405.20 Pln | |
| Chemat | 1g | 890.00 Pln | |
| Chemat | 5g | 2128.40 Pln | |
| Chemat | 10g | 3371.60 Pln | |
| Fluorochem | 5g | 6490.44 Pln | |
| Fluorochem | 50mg | 763.29 Pln | |
| Fluorochem | 100mg | 1023.62 Pln | |
| Fluorochem | 250mg | 1981.61 Pln | |
| Fluorochem | 1g | 4819.15 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Methyl (4S)-2,3-diazabicyclo[3.1.1]heptane-4-carboxylate;hydrochloride (CAS 3104671-22-6) is a chemical compound with the molecular formula C7H13ClN2O2 and a molecular weight of 192.64 g/mol. IUPAC name: methyl (4S)-2,3-diazabicyclo[3.1.1]heptane-4-carboxylate;hydrochloride. InChIKey: XQAWJFWBRKHNPS-MMYXBGEXSA-N.
| Molecular formula | C7H13ClN2O2 |
|---|---|
| Molecular weight | 192.64 g/mol |
| IUPAC name | methyl (4S)-2,3-diazabicyclo[3.1.1]heptane-4-carboxylate;hydrochloride |
| InChIKey | XQAWJFWBRKHNPS-MMYXBGEXSA-N |
| SMILES | COC(=O)[C@@H]1C2CC(C2)NN1.Cl |
Computed by PubChem (NCBI)