cas: 39570-63-3 — see every product listed under this CAS number, including other names
Methyl (S)-2-isocyanato-4-methylpentanoate 98% (CAS 39570-63-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A604386-250mg |
| cas | 39570-63-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 203.50 Pln | |
| Ambeed | 1g | 442.69 Pln | |
| Ambeed | 5g | 1054.56 Pln | |
| Ambeed | 10g | 1594.12 Pln | |
| Ambeed | 25g | 3118.25 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A604386 |
Methyl (2S)-2-isocyanato-4-methylpentanoate (CAS 39570-63-3) is a chemical compound with the molecular formula C8H13NO3 and a molecular weight of 171.19 g/mol. IUPAC name: methyl (2S)-2-isocyanato-4-methylpentanoate. InChIKey: UWFLIWPVRTVDNO-ZETCQYMHSA-N.
| Molecular formula | C8H13NO3 |
|---|---|
| Molecular weight | 171.19 g/mol |
| IUPAC name | methyl (2S)-2-isocyanato-4-methylpentanoate |
| InChIKey | UWFLIWPVRTVDNO-ZETCQYMHSA-N |
| SMILES | CC(C)C[C@@H](C(=O)OC)N=C=O |
Computed by PubChem (NCBI)