cas: 185057-00-5 — see every product listed under this CAS number, including other names
Methyl 1,2,3,4-tetrahydroisoquinoline-6-carboxylate 95% (CAS 185057-00-5) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A708540-50mg |
| cas | 185057-00-5 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 431.56 Pln | |
| Ambeed | 100mg | 604.00 Pln | |
| Ambeed | 250mg | 826.50 Pln | |
| Ambeed | 1g | 2217.12 Pln | |
| Ambeed | 5g | 6511.38 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A708540 |
Methyl 1,2,3,4-tetrahydroisoquinoline-6-carboxylate (CAS 185057-00-5) is a chemical compound with the molecular formula C11H13NO2 and a molecular weight of 191.23 g/mol. IUPAC name: methyl 1,2,3,4-tetrahydroisoquinoline-6-carboxylate. InChIKey: QFGFDECCVRJKHK-UHFFFAOYSA-N.
| Molecular formula | C11H13NO2 |
|---|---|
| Molecular weight | 191.23 g/mol |
| IUPAC name | methyl 1,2,3,4-tetrahydroisoquinoline-6-carboxylate |
| InChIKey | QFGFDECCVRJKHK-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(CNCC2)C=C1 |
Computed by PubChem (NCBI)