cas: 185057-00-5 — see every product listed under this CAS number, including other names
Methyl 1,2,3,4-Tetrahydroisoquinoline-6-Carboxylate, 95%, 95% (CAS 185057-00-5) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1185MK-50mg |
| cas | 185057-00-5 |
| size | 50mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 338.00 Pln | |
| Chemat | 100mg | 472.40 Pln | |
| Chemat | 250mg | 640.40 Pln | |
| Chemat | 1g | 1710.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Methyl 1,2,3,4-tetrahydroisoquinoline-6-carboxylate (CAS 185057-00-5) is a chemical compound with the molecular formula C11H13NO2 and a molecular weight of 191.23 g/mol. IUPAC name: methyl 1,2,3,4-tetrahydroisoquinoline-6-carboxylate. InChIKey: QFGFDECCVRJKHK-UHFFFAOYSA-N.
| Molecular formula | C11H13NO2 |
|---|---|
| Molecular weight | 191.23 g/mol |
| IUPAC name | methyl 1,2,3,4-tetrahydroisoquinoline-6-carboxylate |
| InChIKey | QFGFDECCVRJKHK-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(CNCC2)C=C1 |
Computed by PubChem (NCBI)