cas: 338760-63-7 — see every product listed under this CAS number, including other names
Methyl 1,6-naphthyridine-2-carboxylate, 95%, 95% (CAS 338760-63-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11C7KD-100mg |
| cas | 338760-63-7 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 83.60 Pln | |
| Chemat | 250mg | 112.40 Pln | |
| Chemat | 1g | 246.80 Pln | |
| Chemat | 5g | 986.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Methyl 1,6-naphthyridine-2-carboxylate (CAS 338760-63-7) is a chemical compound with the molecular formula C10H8N2O2 and a molecular weight of 188.18 g/mol. IUPAC name: methyl 1,6-naphthyridine-2-carboxylate. InChIKey: MYBDMKUTAMPZRT-UHFFFAOYSA-N.
| Molecular formula | C10H8N2O2 |
|---|---|
| Molecular weight | 188.18 g/mol |
| IUPAC name | methyl 1,6-naphthyridine-2-carboxylate |
| InChIKey | MYBDMKUTAMPZRT-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=NC2=C(C=C1)C=NC=C2 |
Computed by PubChem (NCBI)